C23H20N4O6S — CID 142306476
[2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 2-nitrobenzoate (PubChem CID 142306476) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 2-nitrobenzoate.
| Compound Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 142306476 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 2-nitrobenzoate |
| SMILES | COc1c(C)cnc(CS(=O)c2nc3ccc(OC(=O)c4ccccc4[N+](=O)[O-])cc3[nH]2)c1C |
| InChI | InChI=1S/C23H20N4O6S/c1-13-11-24-19(14(2)21(13)32-3)12-34(31)23-25-17-9-8-15(10-18(17)26-23)33-22(28)16-6-4-5-7-20(16)27(29)30/h4-11H,12H2,1-3H3,(H,25,26) |
| InChIKey | YHPYXIOBWKVTEJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|