C24H23N3O5S — CID 134349273
[2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 4-methoxybenzoate (PubChem CID 134349273) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 4-methoxybenzoate.
| Compound Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 134349273 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3nc(S(=O)Cc4ncc(C)c(OC)c4C)[nH]c3c2)cc1 |
| InChI | InChI=1S/C24H23N3O5S/c1-14-12-25-21(15(2)22(14)31-4)13-33(29)24-26-19-10-9-18(11-20(19)27-24)32-23(28)16-5-7-17(30-3)8-6-16/h5-12H,13H2,1-4H3,(H,26,27) |
| InChIKey | QWCRTQQJTBKBRR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|