C22H27N3O4S — CID 134349148
[2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 2-ethylbutanoate (PubChem CID 134349148) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 2-ethylbutanoate.
| Compound Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 2-ethylbutanoate |
|---|---|
| PubChem CID | 134349148 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-yl] 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)Oc1ccc2nc(S(=O)Cc3ncc(C)c(OC)c3C)[nH]c2c1 |
| InChI | InChI=1S/C22H27N3O4S/c1-6-15(7-2)21(26)29-16-8-9-17-18(10-16)25-22(24-17)30(27)12-19-14(4)20(28-5)13(3)11-23-19/h8-11,15H,6-7,12H2,1-5H3,(H,24,25) |
| InChIKey | KHDQQHYGVCQTQI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|