C21H26N2O — CID 142308198
[4-[(E)-but-2-en-2-yl]cyclohexyl]-(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)methanone (PubChem CID 142308198) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is [4-[(E)-but-2-en-2-yl]cyclohexyl]-(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)methanone.
| Compound Name | [4-[(E)-but-2-en-2-yl]cyclohexyl]-(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)methanone |
|---|---|
| PubChem CID | 142308198 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | [4-[(E)-but-2-en-2-yl]cyclohexyl]-(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)methanone |
| SMILES | C/C=C(\C)C1CCC(C(=O)c2c(C3CC3)ccn3cncc23)CC1 |
| InChI | InChI=1S/C21H26N2O/c1-3-14(2)15-4-8-17(9-5-15)21(24)20-18(16-6-7-16)10-11-23-13-22-12-19(20)23/h3,10-13,15-17H,4-9H2,1-2H3/b14-3+ |
| InChIKey | ANSCWOOZHZZBPO-LZWSPWQCSA-N |
| XLogP | 5.17 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|