C15H25O3P — CID 142309896
2-(1-methoxy-2,2-dimethylpropoxy)-5-(1-phosphanylpropyl)phenol (PubChem CID 142309896) has the molecular formula C15H25O3P and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(1-methoxy-2,2-dimethylpropoxy)-5-(1-phosphanylpropyl)phenol.
| Compound Name | 2-(1-methoxy-2,2-dimethylpropoxy)-5-(1-phosphanylpropyl)phenol |
|---|---|
| PubChem CID | 142309896 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-(1-methoxy-2,2-dimethylpropoxy)-5-(1-phosphanylpropyl)phenol |
| SMILES | CCC(P)c1ccc(OC(OC)C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C15H25O3P/c1-6-13(19)10-7-8-12(11(16)9-10)18-14(17-5)15(2,3)4/h7-9,13-14,16H,6,19H2,1-5H3 |
| InChIKey | BNKZDVLBGRIBIO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|