C57H35F3N2O4S2 — CID 142310341
[10-[N-(5a,9a-dihydrodibenzothiophen-2-yl)anilino]-5-(11-phenylbenzo[a]carbazol-5-yl)naphtho[1,2-b][1]benzofuran-8-yl] trifluoromethanesulfonate (PubChem CID 142310341) has the molecular formula C57H35F3N2O4S2 and a molecular weight of 933.05 g/mol. Its IUPAC name is [10-[N-(5a,9a-dihydrodibenzothiophen-2-yl)anilino]-5-(11-phenylbenzo[a]carbazol-5-yl)naphtho[1,2-b][1]benzofuran-8-yl] trifluoromethanesulfonate.
| Compound Name | [10-[N-(5a,9a-dihydrodibenzothiophen-2-yl)anilino]-5-(11-phenylbenzo[a]carbazol-5-yl)naphtho[1,2-b][1]benzofuran-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142310341 |
| Molecular Formula | C57H35F3N2O4S2 |
| Molecular Weight | 933.05 g/mol |
| Exact Mass | 932.20 |
| IUPAC Name | [10-[N-(5a,9a-dihydrodibenzothiophen-2-yl)anilino]-5-(11-phenylbenzo[a]carbazol-5-yl)naphtho[1,2-b][1]benzofuran-8-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3c(c2)C2C=CC=CC2S3)c2oc3c4ccccc4c(-c4cc5c6ccccc6n(-c6ccccc6)c5c5ccccc45)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C57H35F3N2O4S2/c58-57(59,60)68(63,64)66-37-30-48-49-33-45(44-32-47-40-21-11-13-25-50(40)62(35-17-5-2-6-18-35)54(47)42-23-9-7-19-38(42)44)39-20-8-10-24-43(39)55(49)65-56(48)51(31-37)61(34-15-3-1-4-16-34)36-27-28-53-46(29-36)41-22-12-14-26-52(41)67-53/h1-33,41,52H |
| InChIKey | SBEJGPVDQXUOFZ-UHFFFAOYSA-N |
| XLogP | 16.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.05 |
| LogP ≤ 5 | 16.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|