C53H33F3N2O4S2 — CID 142310323
[8-naphtho[1,2-b][1]benzothiol-8-yl-4-(N-(9-phenyl-5,6-dihydrocarbazol-2-yl)anilino)dibenzofuran-2-yl] trifluoromethanesulfonate (PubChem CID 142310323) has the molecular formula C53H33F3N2O4S2 and a molecular weight of 882.99 g/mol. Its IUPAC name is [8-naphtho[1,2-b][1]benzothiol-8-yl-4-(N-(9-phenyl-5,6-dihydrocarbazol-2-yl)anilino)dibenzofuran-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-naphtho[1,2-b][1]benzothiol-8-yl-4-(N-(9-phenyl-5,6-dihydrocarbazol-2-yl)anilino)dibenzofuran-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142310323 |
| Molecular Formula | C53H33F3N2O4S2 |
| Molecular Weight | 882.99 g/mol |
| Exact Mass | 882.18 |
| IUPAC Name | [8-naphtho[1,2-b][1]benzothiol-8-yl-4-(N-(9-phenyl-5,6-dihydrocarbazol-2-yl)anilino)dibenzofuran-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3c4c(n(-c5ccccc5)c3c2)C=CCC4)c2oc3ccc(-c4ccc5sc6c7ccccc7ccc6c5c4)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C53H33F3N2O4S2/c54-53(55,56)64(59,60)62-38-30-45-43-27-33(34-21-26-50-44(28-34)42-23-19-32-11-7-8-16-39(32)52(42)63-50)20-25-49(43)61-51(45)48(31-38)57(35-12-3-1-4-13-35)37-22-24-41-40-17-9-10-18-46(40)58(47(41)29-37)36-14-5-2-6-15-36/h1-8,10-16,18-31H,9,17H2 |
| InChIKey | HUOTUIQNLHZCQK-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.99 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|