C47H26F3NO5S2 — CID 153311599
[4-(N-dibenzofuran-3-ylanilino)-8-naphtho[1,2-b][1]benzothiol-5-yldibenzofuran-2-yl] trifluoromethanesulfonate (PubChem CID 153311599) has the molecular formula C47H26F3NO5S2 and a molecular weight of 805.86 g/mol. Its IUPAC name is [4-(N-dibenzofuran-3-ylanilino)-8-naphtho[1,2-b][1]benzothiol-5-yldibenzofuran-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-dibenzofuran-3-ylanilino)-8-naphtho[1,2-b][1]benzothiol-5-yldibenzofuran-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153311599 |
| Molecular Formula | C47H26F3NO5S2 |
| Molecular Weight | 805.86 g/mol |
| Exact Mass | 805.12 |
| IUPAC Name | [4-(N-dibenzofuran-3-ylanilino)-8-naphtho[1,2-b][1]benzothiol-5-yldibenzofuran-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3c(c2)oc2ccccc23)c2oc3ccc(-c4cc5c6ccccc6sc5c5ccccc45)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C47H26F3NO5S2/c48-47(49,50)58(52,53)56-30-24-38-37-22-27(36-26-39-34-14-7-9-17-44(34)57-46(39)35-15-5-4-12-31(35)36)18-21-42(37)55-45(38)40(25-30)51(28-10-2-1-3-11-28)29-19-20-33-32-13-6-8-16-41(32)54-43(33)23-29/h1-26H |
| InChIKey | XJDXIOQUEDGQCZ-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.86 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|