C54H32F3NO4S — CID 153311570
[4-(N-phenylanilino)-8-spiro[benzo[c]fluorene-7,9'-fluorene]-10-yldibenzofuran-2-yl] trifluoromethanesulfonate (PubChem CID 153311570) has the molecular formula C54H32F3NO4S and a molecular weight of 847.91 g/mol. Its IUPAC name is [4-(N-phenylanilino)-8-spiro[benzo[c]fluorene-7,9'-fluorene]-10-yldibenzofuran-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-phenylanilino)-8-spiro[benzo[c]fluorene-7,9'-fluorene]-10-yldibenzofuran-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153311570 |
| Molecular Formula | C54H32F3NO4S |
| Molecular Weight | 847.91 g/mol |
| Exact Mass | 847.20 |
| IUPAC Name | [4-(N-phenylanilino)-8-spiro[benzo[c]fluorene-7,9'-fluorene]-10-yldibenzofuran-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccccc2)c2oc3ccc(-c4ccc5c(c4)-c4c(ccc6ccccc46)C54c5ccccc5-c5ccccc54)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C54H32F3NO4S/c55-54(56,57)63(59,60)62-38-31-43-42-29-35(25-28-50(42)61-52(43)49(32-38)58(36-14-3-1-4-15-36)37-16-5-2-6-17-37)34-24-26-47-44(30-34)51-39-18-8-7-13-33(39)23-27-48(51)53(47)45-21-11-9-19-40(45)41-20-10-12-22-46(41)53/h1-32H |
| InChIKey | YLOJEKOUCPWQOK-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.91 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|