C16H26N2S — CID 142310400
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-(2-methylpropyl)pyrrolidine-1-carbothioamide (PubChem CID 142310400) has the molecular formula C16H26N2S and a molecular weight of 278.47 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-(2-methylpropyl)pyrrolidine-1-carbothioamide.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-(2-methylpropyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 142310400 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-(2-methylpropyl)pyrrolidine-1-carbothioamide |
| SMILES | C=C/C=C\C(=C/C)C1CCN(C(=S)NCC(C)C)C1 |
| InChI | InChI=1S/C16H26N2S/c1-5-7-8-14(6-2)15-9-10-18(12-15)16(19)17-11-13(3)4/h5-8,13,15H,1,9-12H2,2-4H3,(H,17,19)/b8-7-,14-6+ |
| InChIKey | PFLQYEPFNOWUCD-FBOINPIASA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|