C7H8N2S — CID 142310415
6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione (PubChem CID 142310415) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is 6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione.
| Compound Name | 6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
|---|---|
| PubChem CID | 142310415 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
| SMILES | S=c1[nH]cc2n1CC1CC21 |
| InChI | InChI=1S/C7H8N2S/c10-7-8-2-6-5-1-4(5)3-9(6)7/h2,4-5H,1,3H2,(H,8,10) |
| InChIKey | LIYNPMZZGMVBHT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|