C8H10N2S — CID 134377381
(2R,4S)-4-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione (PubChem CID 134377381) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is (2R,4S)-4-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione.
| Compound Name | (2R,4S)-4-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
|---|---|
| PubChem CID | 134377381 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (2R,4S)-4-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
| SMILES | C[C@]12C[C@H]1c1c[nH]c(=S)n1C2 |
| InChI | InChI=1S/C8H10N2S/c1-8-2-5(8)6-3-9-7(11)10(6)4-8/h3,5H,2,4H2,1H3,(H,9,11)/t5-,8+/m0/s1 |
| InChIKey | BLZGVFFHIMESGY-YLWLKBPMSA-N |
| XLogP | 2.05 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|