C13H22N2S — CID 81334529
4-ethyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-imidazole-2-thione (PubChem CID 81334529) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 4-ethyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-imidazole-2-thione.
| Compound Name | 4-ethyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81334529 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4-ethyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-imidazole-2-thione |
| SMILES | CCc1c[nH]c(=S)n1CC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H22N2S/c1-6-9-7-14-11(16)15(9)8-10-12(2,3)13(10,4)5/h7,10H,6,8H2,1-5H3,(H,14,16) |
| InChIKey | VMSQIHVUKRLWGJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|