C14H28N2S — CID 176691279
ethane;4-(2,4,4-trimethylhexan-2-yl)-1,3-dihydroimidazole-2-thione (PubChem CID 176691279) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is ethane;4-(2,4,4-trimethylhexan-2-yl)-1,3-dihydroimidazole-2-thione.
| Compound Name | ethane;4-(2,4,4-trimethylhexan-2-yl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 176691279 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | ethane;4-(2,4,4-trimethylhexan-2-yl)-1,3-dihydroimidazole-2-thione |
| SMILES | CC.CCC(C)(C)CC(C)(C)c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C12H22N2S.C2H6/c1-6-11(2,3)8-12(4,5)9-7-13-10(15)14-9;1-2/h7H,6,8H2,1-5H3,(H2,13,14,15);1-2H3 |
| InChIKey | IKEZGRIPWCQKJN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|