C12H18N4S2 — CID 12676715
4-[2-[(2-sulfanylidene-1,3-dihydroimidazol-4-yl)methyl]pentyl]-1,3-dihydroimidazole-2-thione (PubChem CID 12676715) has the molecular formula C12H18N4S2 and a molecular weight of 282.44 g/mol. Its IUPAC name is 4-[2-[(2-sulfanylidene-1,3-dihydroimidazol-4-yl)methyl]pentyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[2-[(2-sulfanylidene-1,3-dihydroimidazol-4-yl)methyl]pentyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 12676715 |
| Molecular Formula | C12H18N4S2 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[2-[(2-sulfanylidene-1,3-dihydroimidazol-4-yl)methyl]pentyl]-1,3-dihydroimidazole-2-thione |
| SMILES | CCCC(Cc1c[nH]c(=S)[nH]1)Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C12H18N4S2/c1-2-3-8(4-9-6-13-11(17)15-9)5-10-7-14-12(18)16-10/h6-8H,2-5H2,1H3,(H2,13,15,17)(H2,14,16,18) |
| InChIKey | AEWSOFGRIKATKI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|