C12H19NO — CID 142311013
(4E)-4-[(pentan-2-ylideneamino)methylidene]hex-5-en-3-one (PubChem CID 142311013) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (4E)-4-[(pentan-2-ylideneamino)methylidene]hex-5-en-3-one.
| Compound Name | (4E)-4-[(pentan-2-ylideneamino)methylidene]hex-5-en-3-one |
|---|---|
| PubChem CID | 142311013 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (4E)-4-[(pentan-2-ylideneamino)methylidene]hex-5-en-3-one |
| SMILES | C=C/C(=C\N=C(/C)CCC)C(=O)CC |
| InChI | InChI=1S/C12H19NO/c1-5-8-10(4)13-9-11(6-2)12(14)7-3/h6,9H,2,5,7-8H2,1,3-4H3/b11-9+,13-10+ |
| InChIKey | JUYPIFNQTKYHPH-HOJJKJLFSA-N |
| XLogP | 3.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|