C6H7NO — CID 140979367
2,4-dimethylpyrrol-3-one (PubChem CID 140979367) has the molecular formula C6H7NO and a molecular weight of 109.13 g/mol. Its IUPAC name is 2,4-dimethylpyrrol-3-one.
| Compound Name | 2,4-dimethylpyrrol-3-one |
|---|---|
| PubChem CID | 140979367 |
| Molecular Formula | C6H7NO |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.05 |
| IUPAC Name | 2,4-dimethylpyrrol-3-one |
| SMILES | CC1=CN=C(C)C1=O |
| InChI | InChI=1S/C6H7NO/c1-4-3-7-5(2)6(4)8/h3H,1-2H3 |
| InChIKey | TVSWZHIIPZPXON-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |