C11H12N2O — CID 138059173
3,6,7-trimethyl-4aH-quinoxalin-2-one (PubChem CID 138059173) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 3,6,7-trimethyl-4aH-quinoxalin-2-one.
| Compound Name | 3,6,7-trimethyl-4aH-quinoxalin-2-one |
|---|---|
| PubChem CID | 138059173 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3,6,7-trimethyl-4aH-quinoxalin-2-one |
| SMILES | CC1=CC2=NC(=O)C(C)=NC2C=C1C |
| InChI | InChI=1S/C11H12N2O/c1-6-4-9-10(5-7(6)2)13-11(14)8(3)12-9/h4-5,9H,1-3H3 |
| InChIKey | VYCMFMJIAZSKPK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |