C12H12ClNO — CID 138058764
2-(chloromethyl)-6,8-dimethyl-4aH-quinolin-4-one (PubChem CID 138058764) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is 2-(chloromethyl)-6,8-dimethyl-4aH-quinolin-4-one.
| Compound Name | 2-(chloromethyl)-6,8-dimethyl-4aH-quinolin-4-one |
|---|---|
| PubChem CID | 138058764 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2-(chloromethyl)-6,8-dimethyl-4aH-quinolin-4-one |
| SMILES | CC1=CC2C(=O)C=C(CCl)N=C2C(C)=C1 |
| InChI | InChI=1S/C12H12ClNO/c1-7-3-8(2)12-10(4-7)11(15)5-9(6-13)14-12/h3-5,10H,6H2,1-2H3 |
| InChIKey | RHICSAKHSRXSCG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|