C9H9N3O — CID 75089622
2,3-dimethyl-8aH-pyrido[2,3-b]pyrazin-6-one (PubChem CID 75089622) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 2,3-dimethyl-8aH-pyrido[2,3-b]pyrazin-6-one.
| Compound Name | 2,3-dimethyl-8aH-pyrido[2,3-b]pyrazin-6-one |
|---|---|
| PubChem CID | 75089622 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 2,3-dimethyl-8aH-pyrido[2,3-b]pyrazin-6-one |
| SMILES | CC1=NC2=NC(=O)C=CC2N=C1C |
| InChI | InChI=1S/C9H9N3O/c1-5-6(2)11-9-7(10-5)3-4-8(13)12-9/h3-4,7H,1-2H3 |
| InChIKey | HVFIEODPYWVRTH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |