C9H12O — CID 130027254
2,7-dimethylcyclohepta-2,6-dien-1-one (PubChem CID 130027254) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 2,7-dimethylcyclohepta-2,6-dien-1-one.
| Compound Name | 2,7-dimethylcyclohepta-2,6-dien-1-one |
|---|---|
| PubChem CID | 130027254 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2,7-dimethylcyclohepta-2,6-dien-1-one |
| SMILES | CC1=CCCC=C(C)C1=O |
| InChI | InChI=1S/C9H12O/c1-7-5-3-4-6-8(2)9(7)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | OVGLNGCBNHVRHY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |