C7H9IO — CID 144929888
(6-methylcyclohexa-1,5-dien-1-yl) hypoiodite (PubChem CID 144929888) has the molecular formula C7H9IO and a molecular weight of 236.05 g/mol. Its IUPAC name is (6-methylcyclohexa-1,5-dien-1-yl) hypoiodite.
| Compound Name | (6-methylcyclohexa-1,5-dien-1-yl) hypoiodite |
|---|---|
| PubChem CID | 144929888 |
| Molecular Formula | C7H9IO |
| Molecular Weight | 236.05 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | (6-methylcyclohexa-1,5-dien-1-yl) hypoiodite |
| SMILES | CC1=CCCC=C1OI |
| InChI | InChI=1S/C7H9IO/c1-6-4-2-3-5-7(6)9-8/h4-5H,2-3H2,1H3 |
| InChIKey | GXWPVHWCHGSVPB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.05 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|