C9H12O — CID 143020941
2-ethenoxy-3-methylcyclohexa-1,3-diene (PubChem CID 143020941) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 2-ethenoxy-3-methylcyclohexa-1,3-diene.
| Compound Name | 2-ethenoxy-3-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143020941 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2-ethenoxy-3-methylcyclohexa-1,3-diene |
| SMILES | C=COC1=CCCC=C1C |
| InChI | InChI=1S/C9H12O/c1-3-10-9-7-5-4-6-8(9)2/h3,6-7H,1,4-5H2,2H3 |
| InChIKey | RRRYVXAJISNCKS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|