C25H21FN7+ — CID 142311580
[[amino-[1-(8-fluoroquinolin-4-yl)-2-methyl-6-(2-methyl-4-pyridinyl)benzimidazol-4-yl]methylidene]amino]methylideneazanium (PubChem CID 142311580) has the molecular formula C25H21FN7+ and a molecular weight of 438.49 g/mol. Its IUPAC name is [[amino-[1-(8-fluoroquinolin-4-yl)-2-methyl-6-(2-methyl-4-pyridinyl)benzimidazol-4-yl]methylidene]amino]methylideneazanium.
| Compound Name | [[amino-[1-(8-fluoroquinolin-4-yl)-2-methyl-6-(2-methyl-4-pyridinyl)benzimidazol-4-yl]methylidene]amino]methylideneazanium |
|---|---|
| PubChem CID | 142311580 |
| Molecular Formula | C25H21FN7+ |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [[amino-[1-(8-fluoroquinolin-4-yl)-2-methyl-6-(2-methyl-4-pyridinyl)benzimidazol-4-yl]methylidene]amino]methylideneazanium |
| SMILES | Cc1cc(-c2cc(/C(N)=N/C=[NH2+])c3nc(C)n(-c4ccnc5c(F)cccc45)c3c2)ccn1 |
| InChI | InChI=1S/C25H20FN7/c1-14-10-16(6-8-29-14)17-11-19(25(28)31-13-27)24-22(12-17)33(15(2)32-24)21-7-9-30-23-18(21)4-3-5-20(23)26/h3-13H,1-2H3,(H3,27,28,31)/p+1 |
| InChIKey | ZWGRLZMBGPPMCL-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|