C15H20N4O3 — CID 142311805
ethane;[2-[4-(4-ethyltriazol-1-yl)phenyl]-2-oxoethyl] carbamate (PubChem CID 142311805) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethane;[2-[4-(4-ethyltriazol-1-yl)phenyl]-2-oxoethyl] carbamate.
| Compound Name | ethane;[2-[4-(4-ethyltriazol-1-yl)phenyl]-2-oxoethyl] carbamate |
|---|---|
| PubChem CID | 142311805 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | ethane;[2-[4-(4-ethyltriazol-1-yl)phenyl]-2-oxoethyl] carbamate |
| SMILES | CC.CCc1cn(-c2ccc(C(=O)COC(N)=O)cc2)nn1 |
| InChI | InChI=1S/C13H14N4O3.C2H6/c1-2-10-7-17(16-15-10)11-5-3-9(4-6-11)12(18)8-20-13(14)19;1-2/h3-7H,2,8H2,1H3,(H2,14,19);1-2H3 |
| InChIKey | SKWSIXSJKKUUJT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |