C21H29N3O6S — CID 142313842
(1-methylcyclopropyl) N-[2-(1,1-dioxothian-4-yl)-6-(2-methoxyethoxy)-3-methylbenzimidazol-5-yl]carbamate (PubChem CID 142313842) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is (1-methylcyclopropyl) N-[2-(1,1-dioxothian-4-yl)-6-(2-methoxyethoxy)-3-methylbenzimidazol-5-yl]carbamate.
| Compound Name | (1-methylcyclopropyl) N-[2-(1,1-dioxothian-4-yl)-6-(2-methoxyethoxy)-3-methylbenzimidazol-5-yl]carbamate |
|---|---|
| PubChem CID | 142313842 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (1-methylcyclopropyl) N-[2-(1,1-dioxothian-4-yl)-6-(2-methoxyethoxy)-3-methylbenzimidazol-5-yl]carbamate |
| SMILES | COCCOc1cc2nc(C3CCS(=O)(=O)CC3)n(C)c2cc1NC(=O)OC1(C)CC1 |
| InChI | InChI=1S/C21H29N3O6S/c1-21(6-7-21)30-20(25)23-16-12-17-15(13-18(16)29-9-8-28-3)22-19(24(17)2)14-4-10-31(26,27)11-5-14/h12-14H,4-11H2,1-3H3,(H,23,25) |
| InChIKey | LMVFFUOYFXMQOE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|