C18H19ClFNO2 — CID 142316464
[7-chloro-5-(4-ethyl-2-fluorophenyl)-3-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methanol (PubChem CID 142316464) has the molecular formula C18H19ClFNO2 and a molecular weight of 335.81 g/mol. Its IUPAC name is [7-chloro-5-(4-ethyl-2-fluorophenyl)-3-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methanol.
| Compound Name | [7-chloro-5-(4-ethyl-2-fluorophenyl)-3-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 142316464 |
| Molecular Formula | C18H19ClFNO2 |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [7-chloro-5-(4-ethyl-2-fluorophenyl)-3-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methanol |
| SMILES | CCc1ccc(-c2cc(Cl)nc3c2CC(C)C(CO)O3)c(F)c1 |
| InChI | InChI=1S/C18H19ClFNO2/c1-3-11-4-5-12(15(20)7-11)13-8-17(19)21-18-14(13)6-10(2)16(9-22)23-18/h4-5,7-8,10,16,22H,3,6,9H2,1-2H3 |
| InChIKey | KUISFMJYYKAJKP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|