C17H17ClFNO2 — CID 142316353
[7-chloro-5-(4-ethyl-2-fluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methanol (PubChem CID 142316353) has the molecular formula C17H17ClFNO2 and a molecular weight of 321.78 g/mol. Its IUPAC name is [7-chloro-5-(4-ethyl-2-fluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methanol.
| Compound Name | [7-chloro-5-(4-ethyl-2-fluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 142316353 |
| Molecular Formula | C17H17ClFNO2 |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | [7-chloro-5-(4-ethyl-2-fluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methanol |
| SMILES | CCc1ccc(-c2cc(Cl)nc3c2CCC(CO)O3)c(F)c1 |
| InChI | InChI=1S/C17H17ClFNO2/c1-2-10-3-5-12(15(19)7-10)14-8-16(18)20-17-13(14)6-4-11(9-21)22-17/h3,5,7-8,11,21H,2,4,6,9H2,1H3 |
| InChIKey | YQOLRBSXEIASSN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|