C21H17BFNO2 — CID 90372561
CID 90372561 (PubChem CID 90372561) has the molecular formula C21H17BFNO2 and a molecular weight of 345.18 g/mol.
| Compound Name | CID 90372561 |
|---|---|
| PubChem CID | 90372561 |
| Molecular Formula | C21H17BFNO2 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(n1)OC(c1ccc(-c3cc(OC)ccc3F)cc1)CC2 |
| InChI | InChI=1S/C21H17BFNO2/c1-25-16-8-9-18(23)17(12-16)13-2-4-14(5-3-13)19-10-6-15-7-11-20(22)24-21(15)26-19/h2-5,7-9,11-12,19H,6,10H2,1H3 |
| InChIKey | BIDTVRDRMDQVKY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|