C16H14ClF2NO2 — CID 134363714
[7-chloro-5-(2,4-difluorophenyl)-2-methyl-3,4-dihydropyrano[2,3-b]pyridin-2-yl]methanol (PubChem CID 134363714) has the molecular formula C16H14ClF2NO2 and a molecular weight of 325.74 g/mol. Its IUPAC name is [7-chloro-5-(2,4-difluorophenyl)-2-methyl-3,4-dihydropyrano[2,3-b]pyridin-2-yl]methanol.
| Compound Name | [7-chloro-5-(2,4-difluorophenyl)-2-methyl-3,4-dihydropyrano[2,3-b]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 134363714 |
| Molecular Formula | C16H14ClF2NO2 |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [7-chloro-5-(2,4-difluorophenyl)-2-methyl-3,4-dihydropyrano[2,3-b]pyridin-2-yl]methanol |
| SMILES | CC1(CO)CCc2c(-c3ccc(F)cc3F)cc(Cl)nc2O1 |
| InChI | InChI=1S/C16H14ClF2NO2/c1-16(8-21)5-4-11-12(7-14(17)20-15(11)22-16)10-3-2-9(18)6-13(10)19/h2-3,6-7,21H,4-5,8H2,1H3 |
| InChIKey | XUDPHLHDSVFIJG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|