C22H23N3O4 — CID 1423174
3,4-dihydro-1H-isoquinolin-2-yl-[(3S)-1-(3-nitrobenzoyl)piperidin-3-yl]methanone (PubChem CID 1423174) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-[(3S)-1-(3-nitrobenzoyl)piperidin-3-yl]methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-[(3S)-1-(3-nitrobenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 1423174 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-[(3S)-1-(3-nitrobenzoyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCC[C@H](C(=O)N2CCc3ccccc3C2)C1 |
| InChI | InChI=1S/C22H23N3O4/c26-21(17-7-3-9-20(13-17)25(28)29)23-11-4-8-19(15-23)22(27)24-12-10-16-5-1-2-6-18(16)14-24/h1-3,5-7,9,13,19H,4,8,10-12,14-15H2/t19-/m0/s1 |
| InChIKey | GAQXBXLUKRCUHM-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|