C25H30N4O4 — CID 55794212
[1-(3,5-dimethylbenzoyl)piperidin-3-yl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 55794212) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is [1-(3,5-dimethylbenzoyl)piperidin-3-yl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(3,5-dimethylbenzoyl)piperidin-3-yl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55794212 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [1-(3,5-dimethylbenzoyl)piperidin-3-yl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C)cc(C(=O)N2CCCC(C(=O)N3CCN(c4cccc([N+](=O)[O-])c4)CC3)C2)c1 |
| InChI | InChI=1S/C25H30N4O4/c1-18-13-19(2)15-21(14-18)25(31)28-8-4-5-20(17-28)24(30)27-11-9-26(10-12-27)22-6-3-7-23(16-22)29(32)33/h3,6-7,13-16,20H,4-5,8-12,17H2,1-2H3 |
| InChIKey | BAWPYMQKGCVOSS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|