About 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 142318065) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
Analyze 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine?
The IUPAC name of 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CID 142318065) is 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
What is the SMILES notation for 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine?
The canonical SMILES for 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine is Nc1nc2n(n1)C=CCN2.
What is the InChIKey of 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine?
The InChIKey is OVWZSGFXUVYYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5/c6-4-8-5-7-2-1-3-10(5)9-4/h1,3H,2H2,(H3,6,7,8,9).
What are the key properties of 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine?
4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine has a molecular weight of 137.15 g/mol, XLogP of -0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine is sourced from PubChem (CID 142318065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).