C13H25F3O5S — CID 142318314
but-3-enylcyclopentane;propane-2,2-diol;trifluoromethanesulfonic acid (PubChem CID 142318314) has the molecular formula C13H25F3O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is but-3-enylcyclopentane;propane-2,2-diol;trifluoromethanesulfonic acid.
| Compound Name | but-3-enylcyclopentane;propane-2,2-diol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 142318314 |
| Molecular Formula | C13H25F3O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | but-3-enylcyclopentane;propane-2,2-diol;trifluoromethanesulfonic acid |
| SMILES | C=CCCC1CCCC1.CC(C)(O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H16.C3H8O2.CHF3O3S/c1-2-3-6-9-7-4-5-8-9;1-3(2,4)5;2-1(3,4)8(5,6)7/h2,9H,1,3-8H2;4-5H,1-2H3;(H,5,6,7) |
| InChIKey | JMMABOOZZFYFCC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|