C16H30O5S2 — CID 139523819
1,3-dicyclohexyl-2-methylsulfonylpropane-2-sulfonic acid (PubChem CID 139523819) has the molecular formula C16H30O5S2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2-methylsulfonylpropane-2-sulfonic acid.
| Compound Name | 1,3-dicyclohexyl-2-methylsulfonylpropane-2-sulfonic acid |
|---|---|
| PubChem CID | 139523819 |
| Molecular Formula | C16H30O5S2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1,3-dicyclohexyl-2-methylsulfonylpropane-2-sulfonic acid |
| SMILES | CS(=O)(=O)C(CC1CCCCC1)(CC1CCCCC1)S(=O)(=O)O |
| InChI | InChI=1S/C16H30O5S2/c1-22(17,18)16(23(19,20)21,12-14-8-4-2-5-9-14)13-15-10-6-3-7-11-15/h14-15H,2-13H2,1H3,(H,19,20,21) |
| InChIKey | DBWREGVYMQAKQN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|