C9H20ClN3O — CID 142322153
4-methoxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride (PubChem CID 142322153) has the molecular formula C9H20ClN3O and a molecular weight of 221.73 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride.
| Compound Name | 4-methoxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 142322153 |
| Molecular Formula | C9H20ClN3O |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 4-methoxy-N,N-dimethylpiperidine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N(C)C)N1CCC(OC)CC1 |
| InChI | InChI=1S/C9H19N3O.ClH/c1-11(2)9(10)12-6-4-8(13-3)5-7-12;/h8,10H,4-7H2,1-3H3;1H/b10-9+; |
| InChIKey | RIDWMVTYSHKCKO-RRABGKBLSA-N |
| XLogP | 1.02 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|