C21H33NO4 — CID 142323277
N-cyclohexyl-3-(2-methoxyphenoxy)cyclobutane-1-carboxamide;propan-2-ol (PubChem CID 142323277) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is N-cyclohexyl-3-(2-methoxyphenoxy)cyclobutane-1-carboxamide;propan-2-ol.
| Compound Name | N-cyclohexyl-3-(2-methoxyphenoxy)cyclobutane-1-carboxamide;propan-2-ol |
|---|---|
| PubChem CID | 142323277 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N-cyclohexyl-3-(2-methoxyphenoxy)cyclobutane-1-carboxamide;propan-2-ol |
| SMILES | CC(C)O.COc1ccccc1OC1CC(C(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C18H25NO3.C3H8O/c1-21-16-9-5-6-10-17(16)22-15-11-13(12-15)18(20)19-14-7-3-2-4-8-14;1-3(2)4/h5-6,9-10,13-15H,2-4,7-8,11-12H2,1H3,(H,19,20);3-4H,1-2H3 |
| InChIKey | DZADKMKSYWEYFD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |