C20H30ClNO3 — CID 142323142
3-(2-chlorophenoxy)-N-cyclohexylcyclobutane-1-carboxamide;propan-2-ol (PubChem CID 142323142) has the molecular formula C20H30ClNO3 and a molecular weight of 367.92 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-cyclohexylcyclobutane-1-carboxamide;propan-2-ol.
| Compound Name | 3-(2-chlorophenoxy)-N-cyclohexylcyclobutane-1-carboxamide;propan-2-ol |
|---|---|
| PubChem CID | 142323142 |
| Molecular Formula | C20H30ClNO3 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-cyclohexylcyclobutane-1-carboxamide;propan-2-ol |
| SMILES | CC(C)O.O=C(NC1CCCCC1)C1CC(Oc2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H22ClNO2.C3H8O/c18-15-8-4-5-9-16(15)21-14-10-12(11-14)17(20)19-13-6-2-1-3-7-13;1-3(2)4/h4-5,8-9,12-14H,1-3,6-7,10-11H2,(H,19,20);3-4H,1-2H3 |
| InChIKey | JBHDBYNEIFTRIX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |