C21H28N2O4S — CID 134430274
3-(1,3-benzothiazol-4-yloxy)-N-[4-(2-methoxyethoxy)cyclohexyl]cyclobutane-1-carboxamide (PubChem CID 134430274) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-4-yloxy)-N-[4-(2-methoxyethoxy)cyclohexyl]cyclobutane-1-carboxamide.
| Compound Name | 3-(1,3-benzothiazol-4-yloxy)-N-[4-(2-methoxyethoxy)cyclohexyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 134430274 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-(1,3-benzothiazol-4-yloxy)-N-[4-(2-methoxyethoxy)cyclohexyl]cyclobutane-1-carboxamide |
| SMILES | COCCOC1CCC(NC(=O)C2CC(Oc3cccc4scnc34)C2)CC1 |
| InChI | InChI=1S/C21H28N2O4S/c1-25-9-10-26-16-7-5-15(6-8-16)23-21(24)14-11-17(12-14)27-18-3-2-4-19-20(18)22-13-28-19/h2-4,13-17H,5-12H2,1H3,(H,23,24) |
| InChIKey | LHRCNNFDKDKPLL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|