C15H28O — CID 142324708
ethane;(3Z)-2-methylhexa-1,3,5-triene;4-methyloxane (PubChem CID 142324708) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;(3Z)-2-methylhexa-1,3,5-triene;4-methyloxane.
| Compound Name | ethane;(3Z)-2-methylhexa-1,3,5-triene;4-methyloxane |
|---|---|
| PubChem CID | 142324708 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | ethane;(3Z)-2-methylhexa-1,3,5-triene;4-methyloxane |
| SMILES | C=C/C=C\C(=C)C.CC.CC1CCOCC1 |
| InChI | InChI=1S/C7H10.C6H12O.C2H6/c1-4-5-6-7(2)3;1-6-2-4-7-5-3-6;1-2/h4-6H,1-2H2,3H3;6H,2-5H2,1H3;1-2H3/b6-5-;; |
| InChIKey | XWECOKMNYCGJLH-XNOMRPDFSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|