About ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole
ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (PubChem CID 142324749) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
Analyze ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The IUPAC name of ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (CID 142324749) is ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
What is the SMILES notation for ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The canonical SMILES for ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is CC.Cc1cnn2c1CCC2.
What is the InChIKey of ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The InChIKey is FOSIBZADDXSFBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C2H6/c1-6-5-8-9-4-2-3-7(6)9;1-2/h5H,2-4H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole has a molecular weight of 152.24 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is sourced from PubChem (CID 142324749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).