About 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole
3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (PubChem CID 71531119) has the molecular formula C12H11FN2
and a molecular weight of 202.23 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| PubChem CID | 71531119 |
| Molecular Formula | C12H11FN2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| SMILES | Fc1ccc(-c2cnn3c2CCC3)cc1 |
| InChI | InChI=1S/C12H11FN2/c13-10-5-3-9(4-6-10)11-8-14-15-7-1-2-12(11)15/h3-6,8H,1-2,7H2 |
| InChIKey | NJCFPOWYXRHKPN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The IUPAC name of 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (CID 71531119) is 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
What is the SMILES notation for 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The canonical SMILES for 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is Fc1ccc(-c2cnn3c2CCC3)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The InChIKey is NJCFPOWYXRHKPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2/c13-10-5-3-9(4-6-10)11-8-14-15-7-1-2-12(11)15/h3-6,8H,1-2,7H2.
What are the key properties of 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole has a molecular weight of 202.23 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is sourced from PubChem (CID 71531119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).