C28H28N6O2 — CID 142326985
N-[4-benzyl-1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]piperidin-4-yl]formamide (PubChem CID 142326985) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is N-[4-benzyl-1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]piperidin-4-yl]formamide.
| Compound Name | N-[4-benzyl-1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]piperidin-4-yl]formamide |
|---|---|
| PubChem CID | 142326985 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[4-benzyl-1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]piperidin-4-yl]formamide |
| SMILES | CCOc1cc(-c2ccc(N3CCC(Cc4ccccc4)(NC=O)CC3)nc2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C28H28N6O2/c1-2-36-24-14-25(27-23(16-29)18-32-34(27)19-24)22-8-9-26(30-17-22)33-12-10-28(11-13-33,31-20-35)15-21-6-4-3-5-7-21/h3-9,14,17-20H,2,10-13,15H2,1H3,(H,31,35) |
| InChIKey | UHFFRCKSQCXATN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|