C28H29N7O2 — CID 170451013
N-[4-benzyl-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]piperidin-4-yl]formamide (PubChem CID 170451013) has the molecular formula C28H29N7O2 and a molecular weight of 495.59 g/mol. Its IUPAC name is N-[4-benzyl-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]piperidin-4-yl]formamide.
| Compound Name | N-[4-benzyl-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]piperidin-4-yl]formamide |
|---|---|
| PubChem CID | 170451013 |
| Molecular Formula | C28H29N7O2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | N-[4-benzyl-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]piperidin-4-yl]formamide |
| SMILES | CCOc1cc(-c2ccc(N3CCC(Cc4ccccc4)(NC=O)CC3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C28H29N7O2/c1-2-37-22-14-23(26-24-17-31-32-27(24)33-35(26)18-22)21-8-9-25(29-16-21)34-12-10-28(11-13-34,30-19-36)15-20-6-4-3-5-7-20/h3-9,14,16-19H,2,10-13,15H2,1H3,(H,30,36)(H,32,33) |
| InChIKey | PMCOEJJGQCPXOC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|