C19H21N7O — CID 170450847
(3R)-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]pyrrolidin-3-amine (PubChem CID 170450847) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is (3R)-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 170450847 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (3R)-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]pyrrolidin-3-amine |
| SMILES | CCOc1cc(-c2ccc(N3CC[C@@H](N)C3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C19H21N7O/c1-2-27-14-7-15(18-16-9-22-23-19(16)24-26(18)11-14)12-3-4-17(21-8-12)25-6-5-13(20)10-25/h3-4,7-9,11,13H,2,5-6,10,20H2,1H3,(H,23,24)/t13-/m1/s1 |
| InChIKey | KKCVOMGMQVORPD-CYBMUJFWSA-N |
| XLogP | 2.21 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |