C20H23N7O5S — CID 170429911
12-[6-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-3-pyridinyl]-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene;sulfuric acid (PubChem CID 170429911) has the molecular formula C20H23N7O5S and a molecular weight of 473.52 g/mol. Its IUPAC name is 12-[6-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-3-pyridinyl]-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene;sulfuric acid.
| Compound Name | 12-[6-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-3-pyridinyl]-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene;sulfuric acid |
|---|---|
| PubChem CID | 170429911 |
| Molecular Formula | C20H23N7O5S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 12-[6-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-3-pyridinyl]-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene;sulfuric acid |
| SMILES | CCOc1cc(-c2ccc(N3CC4CC(C3)N4)nc2)c2c3cn[nH]c3nn2c1.O=S(=O)(O)O |
| InChI | InChI=1S/C20H21N7O.H2O4S/c1-2-28-15-6-16(19-17-8-22-24-20(17)25-27(19)11-15)12-3-4-18(21-7-12)26-9-13-5-14(10-26)23-13;1-5(2,3)4/h3-4,6-8,11,13-14,23H,2,5,9-10H2,1H3,(H,24,25);(H2,1,2,3,4) |
| InChIKey | KVXWGMLYBOPGKQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|