C27H25F2N7O3 — CID 171593161
N-[(3R,4S)-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]-3-hydroxypiperidin-4-yl]-2,6-difluorobenzamide (PubChem CID 171593161) has the molecular formula C27H25F2N7O3 and a molecular weight of 533.54 g/mol. Its IUPAC name is N-[(3R,4S)-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]-3-hydroxypiperidin-4-yl]-2,6-difluorobenzamide.
| Compound Name | N-[(3R,4S)-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]-3-hydroxypiperidin-4-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 171593161 |
| Molecular Formula | C27H25F2N7O3 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | N-[(3R,4S)-1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]-3-hydroxypiperidin-4-yl]-2,6-difluorobenzamide |
| SMILES | CCOc1cc(-c2ccc(N3CC[C@H](NC(=O)c4c(F)cccc4F)[C@H](O)C3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C27H25F2N7O3/c1-2-39-16-10-17(25-18-12-31-33-26(18)34-36(25)13-16)15-6-7-23(30-11-15)35-9-8-21(22(37)14-35)32-27(38)24-19(28)4-3-5-20(24)29/h3-7,10-13,21-22,37H,2,8-9,14H2,1H3,(H,32,38)(H,33,34)/t21-,22+/m0/s1 |
| InChIKey | VGKWPXRNLRCQSD-FCHUYYIVSA-N |
| XLogP | 3.32 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |