C21H24N6O — CID 175757302
10-ethoxy-12-[6-(4-methylpiperidin-1-yl)-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene (PubChem CID 175757302) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 10-ethoxy-12-[6-(4-methylpiperidin-1-yl)-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene.
| Compound Name | 10-ethoxy-12-[6-(4-methylpiperidin-1-yl)-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
|---|---|
| PubChem CID | 175757302 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 10-ethoxy-12-[6-(4-methylpiperidin-1-yl)-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
| SMILES | CCOc1cc(-c2ccc(N3CCC(C)CC3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C21H24N6O/c1-3-28-16-10-17(20-18-12-23-24-21(18)25-27(20)13-16)15-4-5-19(22-11-15)26-8-6-14(2)7-9-26/h4-5,10-14H,3,6-9H2,1-2H3,(H,24,25) |
| InChIKey | SVWZTOVFYARFHN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |