C23H27N7O — CID 170430085
12-[6-(2,6-diazaspiro[4.5]decan-2-yl)-3-pyridinyl]-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene (PubChem CID 170430085) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is 12-[6-(2,6-diazaspiro[4.5]decan-2-yl)-3-pyridinyl]-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene.
| Compound Name | 12-[6-(2,6-diazaspiro[4.5]decan-2-yl)-3-pyridinyl]-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
|---|---|
| PubChem CID | 170430085 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 12-[6-(2,6-diazaspiro[4.5]decan-2-yl)-3-pyridinyl]-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
| SMILES | CCOc1cc(-c2ccc(N3CCC4(CCCCN4)C3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C23H27N7O/c1-2-31-17-11-18(21-19-13-26-27-22(19)28-30(21)14-17)16-5-6-20(24-12-16)29-10-8-23(15-29)7-3-4-9-25-23/h5-6,11-14,25H,2-4,7-10,15H2,1H3,(H,27,28) |
| InChIKey | FNOFITBYTCVKIX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |