C24H27N7O3 — CID 174236066
2-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]-2,6-diazaspiro[4.5]decane-6-carboxylic acid (PubChem CID 174236066) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is 2-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]-2,6-diazaspiro[4.5]decane-6-carboxylic acid.
| Compound Name | 2-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]-2,6-diazaspiro[4.5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 174236066 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]-2,6-diazaspiro[4.5]decane-6-carboxylic acid |
| SMILES | CCOc1cc(-c2ccc(N3CCC4(CCCCN4C(=O)O)C3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C24H27N7O3/c1-2-34-17-11-18(21-19-13-26-27-22(19)28-31(21)14-17)16-5-6-20(25-12-16)29-10-8-24(15-29)7-3-4-9-30(24)23(32)33/h5-6,11-14H,2-4,7-10,15H2,1H3,(H,27,28)(H,32,33) |
| InChIKey | OUVGLHVKDQKPHN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |